CAS 261763-05-7 appears in our catalog under these names: 3-Chloro-2-fluoro-5-(trifluoromethyl)benzyl alcohol, 95%, 3-Chloro-2-fluoro-5-(trifluoromethyl)benzylalcohol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methanol (CAS 261763-05-7) is a chemical compound with the molecular formula C8H5ClF4O and a molecular weight of 228.57 g/mol. IUPAC name: [3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methanol. InChIKey: TXEZAXDRQCONER-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4O |
|---|---|
| Molecular weight | 228.57 g/mol |
| IUPAC name | [3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | TXEZAXDRQCONER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)