CAS 62492-41-5 appears in our catalog under these names: 1–Chloro–2–methoxy–5–methyl–4–nitrobenzene, 1-Chloro-2-methoxy-5-methyl-4-nitrobenzene, 95%, 95%, 1-Chloro-2-methoxy-5-methyl-4-nitrobenzene, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-chloro-2-methoxy-5-methyl-4-nitrobenzene (CAS 62492-41-5) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 1-chloro-2-methoxy-5-methyl-4-nitrobenzene. InChIKey: CNOXJOUJOZTIKY-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 1-chloro-2-methoxy-5-methyl-4-nitrobenzene |
| InChIKey | CNOXJOUJOZTIKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])OC)Cl |
Computed by PubChem (NCBI)