Products 2069250-63-9
CAS 2069250-63-9 appears in our catalog under these names: 3-(Chloromethyl)-5-nitrobenzyl alcohol, 95%, 3-(Chloromethyl)-5-nitrobenzenemethanol, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
[3-(chloromethyl)-5-nitrophenyl]methanol (CAS 2069250-63-9) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: [3-(chloromethyl)-5-nitrophenyl]methanol. InChIKey: BFSSQCKPYXOGFN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | [3-(chloromethyl)-5-nitrophenyl]methanol |
| InChIKey | BFSSQCKPYXOGFN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1CCl)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)