cas: 87945-06-0 — see every product listed under this CAS number, including other names
1-Chloro-3,5-diisopropylbenzene 95% (CAS 87945-06-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A673577-50mg |
| cas | 87945-06-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 503.88 Pln | |
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1644.19 Pln | |
| Ambeed | 5g | 4792.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A673577 |
1-chloro-3,5-di(propan-2-yl)benzene (CAS 87945-06-0) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 1-chloro-3,5-di(propan-2-yl)benzene. InChIKey: IJPBANLIWUXUPV-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 1-chloro-3,5-di(propan-2-yl)benzene |
| InChIKey | IJPBANLIWUXUPV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)Cl)C(C)C |
Computed by PubChem (NCBI)