CAS 87945-06-0 appears in our catalog under these names: 1-Chloro-3,5-diisopropylbenzene, 95%, 1–Chloro–3,5–diisopropylbenzene, 1-Chloro-3,5-diisopropylbenzene 95%, 3,5-DIISOPROPYL-1-CHLOROBENZENE, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g, 10g.
1-chloro-3,5-di(propan-2-yl)benzene (CAS 87945-06-0) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 1-chloro-3,5-di(propan-2-yl)benzene. InChIKey: IJPBANLIWUXUPV-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 1-chloro-3,5-di(propan-2-yl)benzene |
| InChIKey | IJPBANLIWUXUPV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)Cl)C(C)C |
Computed by PubChem (NCBI)