cas: 37985-13-0 — see every product listed under this CAS number, including other names
1-Chloro-4-((1E,3E)-4-phenylbuta-1,3-dien-1-yl)benzene, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 37985-13-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKJP-1g |
| cas | 37985-13-0 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 544.40 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (CAS 37985-13-0) is a chemical compound with the molecular formula C16H13Cl and a molecular weight of 240.72 g/mol. IUPAC name: 1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene. InChIKey: LASZRNUFCYQISX-KBXRYBNXSA-N.
| Molecular formula | C16H13Cl |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | 1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| InChIKey | LASZRNUFCYQISX-KBXRYBNXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)