CAS 37985-13-0 appears in our catalog under these names: 1-Chloro-4-((1e,3e)-4-phenylbuta-1,3-dien-1-yl)benzene, 95%, 1–Chloro–4–((1E,3E)–4–phenylbuta–1,3–dien–1–yl)benzene, 1-Chloro-4-((1E,3E)-4-phenylbuta-1,3-dien-1-yl)benzene, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 25g, 5g, 1g.
1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (CAS 37985-13-0) is a chemical compound with the molecular formula C16H13Cl and a molecular weight of 240.72 g/mol. IUPAC name: 1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene. InChIKey: LASZRNUFCYQISX-KBXRYBNXSA-N.
| Molecular formula | C16H13Cl |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | 1-chloro-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| InChIKey | LASZRNUFCYQISX-KBXRYBNXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)