cas: 142770-42-1 — see every product listed under this CAS number, including other names
1-Chloro-4-Propoxy-9H-Thioxanthen-9-One, 97%, 97% (CAS 142770-42-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 15g, 250g, 250mg, 1g, 5g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117XIN-10g |
| cas | 142770-42-1 |
| size | 10g |
| availability | 748g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 242.00 Pln | |
| Chemat | 15g | 323.60 Pln | |
| Chemat | 250g | 2541.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 25g | 357.20 Pln | |
| Chemat | 50g | 635.60 Pln | |
| Chemat | 100g | 1187.60 Pln | |
| Chemat | 500g | 4440.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloro-4-propoxythioxanthen-9-one (CAS 142770-42-1) is a chemical compound with the molecular formula C16H13ClO2S and a molecular weight of 304.8 g/mol. IUPAC name: 1-chloro-4-propoxythioxanthen-9-one. InChIKey: VKQJCUYEEABXNK-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO2S |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 1-chloro-4-propoxythioxanthen-9-one |
| InChIKey | VKQJCUYEEABXNK-UHFFFAOYSA-N |
| SMILES | CCCOC1=C2C(=C(C=C1)Cl)C(=O)C3=CC=CC=C3S2 |
Computed by PubChem (NCBI)