CAS 103597-06-4 is the registry number for 3-Chloro-6-methoxy-2-(4-methoxyphenyl)benzo(b)thiophene. Offered by: TRC. Available pack sizes: 100mg, 10mg.
3-chloro-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene (CAS 103597-06-4) is a chemical compound with the molecular formula C16H13ClO2S and a molecular weight of 304.8 g/mol. IUPAC name: 3-chloro-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene. InChIKey: FGWOVHJKUHVFPC-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO2S |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 3-chloro-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene |
| InChIKey | FGWOVHJKUHVFPC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C3=C(S2)C=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)