cas: 41252-95-3 — see every product listed under this CAS number, including other names
1-Chloro-4-iodo-2-nitrobenzene 97% (CAS 41252-95-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A159955-250mg |
| cas | 41252-95-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 615.13 Pln | |
| Ambeed | 25g | 1288.19 Pln | |
| Ambeed | 100g | 3646.69 Pln | |
| Ambeed | 500g | 14376.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A159955 |
1-chloro-4-iodo-2-nitrobenzene (CAS 41252-95-3) is a chemical compound with the molecular formula C6H3ClINO2 and a molecular weight of 283.45 g/mol. IUPAC name: 1-chloro-4-iodo-2-nitrobenzene. InChIKey: YHIUICUDBKZVBE-UHFFFAOYSA-N.
| Molecular formula | C6H3ClINO2 |
|---|---|
| Molecular weight | 283.45 g/mol |
| IUPAC name | 1-chloro-4-iodo-2-nitrobenzene |
| InChIKey | YHIUICUDBKZVBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)