CAS 89284-60-6 appears in our catalog under these names: 2-Chloro-4-iodo-1-nitrobenzene, 95%, 2-Chloro-4-iodo-1-nitrobenzene, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
2-chloro-4-iodo-1-nitrobenzene (CAS 89284-60-6) is a chemical compound with the molecular formula C6H3ClINO2 and a molecular weight of 283.45 g/mol. IUPAC name: 2-chloro-4-iodo-1-nitrobenzene. InChIKey: XFZDMPIWHWAUGI-UHFFFAOYSA-N.
| Molecular formula | C6H3ClINO2 |
|---|---|
| Molecular weight | 283.45 g/mol |
| IUPAC name | 2-chloro-4-iodo-1-nitrobenzene |
| InChIKey | XFZDMPIWHWAUGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)