1-Chloro-4-iodo-2-nitrobenzene, 97%
cas: 41252-95-3 — see every product listed under this CAS number, including other names
1-Chloro-4-iodo-2-nitrobenzene, 97% (CAS 41252-95-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g, 100mg, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A159955-250mg |
| cas | 41252-95-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 25g | 1304.88 Pln | |
| Ambeed | 100g | 3685.62 Pln | |
| Ambeed | 500g | 14526.94 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 403.22 Pln | |
| BLDpharm | 10g | 664.24 Pln | |
| BLDpharm | 25g | 1397.31 Pln | |
| BLDpharm | 100g | 3968.63 Pln | |
| BLDpharm | 500g | 15658.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-chloro-4-iodo-2-nitrobenzene (CAS 41252-95-3) is a chemical compound with the molecular formula C6H3ClINO2 and a molecular weight of 283.45 g/mol. IUPAC name: 1-chloro-4-iodo-2-nitrobenzene. InChIKey: YHIUICUDBKZVBE-UHFFFAOYSA-N.
| Molecular formula | C6H3ClINO2 |
|---|---|
| Molecular weight | 283.45 g/mol |
| IUPAC name | 1-chloro-4-iodo-2-nitrobenzene |
| InChIKey | YHIUICUDBKZVBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)