CAS 2142655-40-9 appears in our catalog under these names: 1-Chloronaphthalene-5-boronic acid, 96%, 1-Chloronaphthalene-5-boronic acid, 98%, 98%, 1-Chloronaphthalene-5-boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(5-chloronaphthalen-1-yl)boronic acid (CAS 2142655-40-9) is a chemical compound with the molecular formula C10H8BClO2 and a molecular weight of 206.43 g/mol. IUPAC name: (5-chloronaphthalen-1-yl)boronic acid. InChIKey: BSSDYINOXISHRI-UHFFFAOYSA-N.
| Molecular formula | C10H8BClO2 |
|---|---|
| Molecular weight | 206.43 g/mol |
| IUPAC name | (5-chloronaphthalen-1-yl)boronic acid |
| InChIKey | BSSDYINOXISHRI-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C(C2=CC=C1)Cl)(O)O |
Computed by PubChem (NCBI)