1-Cyclohexyl-3-mesityl-1H-imidazol-3-ium chloride, 98%
cas: 1583244-03-4 — see every product listed under this CAS number, including other names
1-Cyclohexyl-3-mesityl-1H-imidazol-3-ium chloride, 98% (CAS 1583244-03-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XC2Q-250mg |
| cas | 1583244-03-4 |
| size | 250mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 3424.40 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 5g | 5209.64 Pln | |
| Fluorochem | 250mg | 461.31 Pln | |
| Fluorochem | 1g | 1106.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-cyclohexyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride (CAS 1583244-03-4) is a chemical compound with the molecular formula C18H25ClN2 and a molecular weight of 304.9 g/mol. IUPAC name: 1-cyclohexyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride. InChIKey: QRJRTELRLIOWGZ-UHFFFAOYSA-M.
| Molecular formula | C18H25ClN2 |
|---|---|
| Molecular weight | 304.9 g/mol |
| IUPAC name | 1-cyclohexyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride |
| InChIKey | QRJRTELRLIOWGZ-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3CCCCC3)C.[Cl-] |
Computed by PubChem (NCBI)