1-Cyclohexylpyrrolidine, 95%
cas: 7731-02-4 — see every product listed under this CAS number, including other names
1-Cyclohexylpyrrolidine, 95% (CAS 7731-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A626670-100mg |
| cas | 7731-02-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1894.50 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 2035.97 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 851.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-cyclohexylpyrrolidine is an N-alkylpyrrolidine that is pyrrolidine in which the hydrogen attached to the nitrogen has been replaced by a cyclohexyl group.
Source: ChEBI
| Molecular formula | C10H19N |
|---|---|
| Molecular weight | 153.26 g/mol |
| IUPAC name | 1-cyclohexylpyrrolidine |
| InChIKey | ULBBXWVIXXPSOD-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2CCCC2 |
Computed by PubChem (NCBI)
Synonyms:
1-cyclohexylpyrrolidine, N-cyclohexylpyrrolidine, Pyrrolidine, 1-cyclohexyl-, Pyrrolidine,1-cyclohexyl-, cyclohexylpyrrolidine, cyclohexyl pyrrolidine, 1-(1-pyrrolidinyl)cyclohexane, Pyrrole, 1-phenyl- (8CI), 1H-Pyrrole, 1-phenyl- (9CI), InChI=1/C10H19N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h10H,1-9H