CAS 32511-34-5 appears in our catalog under these names: (R)-(+)-Bornylamine, 97%, (R)-(+)-Bornylamine. Offered by: Combi-blocks, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 2g, 5g, 10g, 500mg.
(1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine (CAS 32511-34-5) is a chemical compound with the molecular formula C10H19N and a molecular weight of 153.26 g/mol. IUPAC name: (1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine. InChIKey: MDFWXZBEVCOVIO-WEDXCCLWSA-N.
| Molecular formula | C10H19N |
|---|---|
| Molecular weight | 153.26 g/mol |
| IUPAC name | (1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
| InChIKey | MDFWXZBEVCOVIO-WEDXCCLWSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)C[C@@H]2N |
Computed by PubChem (NCBI)