cas: 1048971-66-9 — see every product listed under this CAS number, including other names
1-Cyclopentyl-1-tosylmethyl isocyanide, 95+%, 95+% (CAS 1048971-66-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119RQ1-100mg |
| cas | 1048971-66-9 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1370.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene (CAS 1048971-66-9) is a chemical compound with the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. IUPAC name: 1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene. InChIKey: SNBRQNBTPMQAPH-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | 1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene |
| InChIKey | SNBRQNBTPMQAPH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2CCCC2)[N+]#[C-] |
Computed by PubChem (NCBI)