Products 1048971-66-9
CAS 1048971-66-9 appears in our catalog under these names: 1-Cyclopentyl-1-tosylmethyl isocyanide, 95%, 1-Cyclopentyl-1-tosylmethyl isocyanide 95+%, 1-Cyclopentyl-1-tosylmethyl isocyanide, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene (CAS 1048971-66-9) is a chemical compound with the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. IUPAC name: 1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene. InChIKey: SNBRQNBTPMQAPH-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | 1-[cyclopentyl(isocyano)methyl]sulfonyl-4-methylbenzene |
| InChIKey | SNBRQNBTPMQAPH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2CCCC2)[N+]#[C-] |
Computed by PubChem (NCBI)