cas: 874297-80-0 — see every product listed under this CAS number, including other names
1-Cyclopentyl-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 874297-80-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115FYM-250mg |
| cas | 874297-80-0 |
| size | 250mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-cyclopentyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874297-80-0) is a chemical compound with the molecular formula C18H27BN2O3 and a molecular weight of 330.2 g/mol. IUPAC name: 1-cyclopentyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: XIRYAWDMLJRGHR-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 1-cyclopentyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | XIRYAWDMLJRGHR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NC3CCCC3 |
Computed by PubChem (NCBI)