1-Deoxynojirimycin 98%
cas: 19130-96-2 — see every product listed under this CAS number, including other names
1-Deoxynojirimycin 98% (CAS 19130-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235571-1mg |
| cas | 19130-96-2 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 147.88 Pln | |
| Ambeed | 2mg | 164.56 Pln | |
| Ambeed | 5mg | 186.81 Pln | |
| Ambeed | 10mg | 209.06 Pln | |
| Ambeed | 25mg | 242.44 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1616.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A235571 |
Duvoglustat is an optically active form of 2-(hydroxymethyl)piperidine-3,4,5-triol having 2R,3R,4R,5S-configuration. It has a role as a hypoglycemic agent, a hepatoprotective agent, an anti-HIV agent, an EC 3.2.1.20 (alpha-glucosidase) inhibitor, an anti-obesity agent, a plant metabolite and a bacterial metabolite. It is a piperidine alkaloid and a 2-(hydroxymethyl)piperidine-3,4,5-triol.
Source: ChEBI
| Molecular formula | C6H13NO4 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | LXBIFEVIBLOUGU-JGWLITMVSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O |
Computed by PubChem (NCBI)