CAS 143314-14-1 appears in our catalog under these names: 1-Ethyl-3-methylimidazolium Nitrate, 99%, 99%, 1-Ethyl-3-methylimidazolium Nitrate, >98.0%(HPLC)(T), 1-ETHYL-3-METHYLIMIDAZOLIUM NITRATE, 98%+(HPLC),RG, 3–Ethyl–1–methyl–1H–imidazol–3–ium Nitrate. Offered by: Chemat, TCI, Fluorochem, GLPBio. Available pack sizes: 10g, 15g, 1g, 5g, 25g, 100g.
1-ethyl-3-methylimidazol-3-ium nitrate (CAS 143314-14-1) is a chemical compound with the molecular formula C6H11N3O3 and a molecular weight of 173.17 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium nitrate. InChIKey: JDOJFSVGXRJFLL-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O3 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium nitrate |
| InChIKey | JDOJFSVGXRJFLL-UHFFFAOYSA-N |
| SMILES | CCN1C=C[N+](=C1)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)