CAS 1205674-38-9 appears in our catalog under these names: 1,2,3-Propanetricarboxamide, 98%, 1,2,3–Propanetricarboxamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
Propane-1,2,3-tricarboxamide (CAS 1205674-38-9) is a chemical compound with the molecular formula C6H11N3O3 and a molecular weight of 173.17 g/mol. IUPAC name: propane-1,2,3-tricarboxamide. InChIKey: APCDASFMETWCPU-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O3 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | propane-1,2,3-tricarboxamide |
| InChIKey | APCDASFMETWCPU-UHFFFAOYSA-N |
| SMILES | C(C(CC(=O)N)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)