cas: 850331-04-3 — see every product listed under this CAS number, including other names
1-Ethyl-3-methyl-1H-imidazol-3-ium tetrachloroferrate(III) 98% (CAS 850331-04-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A634828-1g |
| cas | 850331-04-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A634828 |
1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-) (CAS 850331-04-3) is a chemical compound with the molecular formula C6H11Cl4FeN2 and a molecular weight of 308.8 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-). InChIKey: VGSZFQMHQHFXCD-UHFFFAOYSA-J.
| Molecular formula | C6H11Cl4FeN2 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-) |
| InChIKey | VGSZFQMHQHFXCD-UHFFFAOYSA-J |
| SMILES | CCN1C=C[N+](=C1)C.Cl[Fe-](Cl)(Cl)Cl |
Computed by PubChem (NCBI)