cas: 847818-70-6 — see every product listed under this CAS number, including other names
1-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole, 98%, 98% (CAS 847818-70-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143R7-250mg |
| cas | 847818-70-6 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 376.40 Pln | |
| Chemat | 100g | 1168.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-70-6) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: UGCRHVPUHAXAAE-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | UGCRHVPUHAXAAE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC |
Computed by PubChem (NCBI)