cas: 1007110-53-3 — see every product listed under this CAS number, including other names
1-Ethylpyrazole-5-boronic Acid Pinacol Ester 98% (CAS 1007110-53-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A271129-250mg |
| cas | 1007110-53-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 509.44 Pln | |
| Ambeed | 25g | 782.00 Pln | |
| Ambeed | 100g | 2795.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A271129 |
1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1007110-53-3) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: PKJCXHILXIEALN-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | PKJCXHILXIEALN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2CC |
Computed by PubChem (NCBI)