cas: 88074-73-1 — see every product listed under this CAS number, including other names
1-Ethynyl-4-(trans-4-propylcyclohexyl)benzene, ≥98%, ≥98% (CAS 88074-73-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115HPU-25mg |
| cas | 88074-73-1 |
| size | 25mg |
| availability | 85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 122.00 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 200mg | 218.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-ethynyl-4-(4-propylcyclohexyl)benzene (CAS 88074-73-1) is a chemical compound with the molecular formula C17H22 and a molecular weight of 226.36 g/mol. IUPAC name: 1-ethynyl-4-(4-propylcyclohexyl)benzene. InChIKey: HLUVLSYQSNGSKG-UHFFFAOYSA-N.
| Molecular formula | C17H22 |
|---|---|
| Molecular weight | 226.36 g/mol |
| IUPAC name | 1-ethynyl-4-(4-propylcyclohexyl)benzene |
| InChIKey | HLUVLSYQSNGSKG-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(CC1)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)