CAS 1459-55-8 appears in our catalog under these names: P-(1-Adamantyl)toluene, 95%, p-(1-Adamantyl)toluene, >95.0%(GC), p-(1-Adamantyl)toluene 98%, 1-(p-Tolyl)adamantane, 98%, 98%, 1-(p-Tolyl)adamantane, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(4-methylphenyl)adamantane (CAS 1459-55-8) is a chemical compound with the molecular formula C17H22 and a molecular weight of 226.36 g/mol. IUPAC name: 1-(4-methylphenyl)adamantane. InChIKey: RFQXTZGKFOTWFL-UHFFFAOYSA-N.
| Molecular formula | C17H22 |
|---|---|
| Molecular weight | 226.36 g/mol |
| IUPAC name | 1-(4-methylphenyl)adamantane |
| InChIKey | RFQXTZGKFOTWFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)