cas: 636-98-6 — see every product listed under this CAS number, including other names
1-Iodo-4-nitrobenzene, 99% (CAS 636-98-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 122380250 |
| cas | 636-98-6 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 306.02 Pln | |
| Thermo Scientific (Acros) | 100g | 975.52 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1-iodo-4-nitrobenzene (CAS 636-98-6) is a chemical compound with the molecular formula C6H4INO2 and a molecular weight of 249.01 g/mol. IUPAC name: 1-iodo-4-nitrobenzene. InChIKey: SCCCFNJTCDSLCY-UHFFFAOYSA-N.
| Molecular formula | C6H4INO2 |
|---|---|
| Molecular weight | 249.01 g/mol |
| IUPAC name | 1-iodo-4-nitrobenzene |
| InChIKey | SCCCFNJTCDSLCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])I |
Computed by PubChem (NCBI)