CAS 609-73-4 appears in our catalog under these names: 1-Iodo-2-nitrobenzene, 97%, 1-Iodo-2-nitrobenzene, 97% , 1-Iodo-2-nitrobenzene, >99.0%(GC). Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
1-iodo-2-nitrobenzene (CAS 609-73-4) is a chemical compound with the molecular formula C6H4INO2 and a molecular weight of 249.01 g/mol. IUPAC name: 1-iodo-2-nitrobenzene. InChIKey: JXMZUNPWVXQADG-UHFFFAOYSA-N.
| Molecular formula | C6H4INO2 |
|---|---|
| Molecular weight | 249.01 g/mol |
| IUPAC name | 1-iodo-2-nitrobenzene |
| InChIKey | JXMZUNPWVXQADG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)