cas: 777063-41-9 — see every product listed under this CAS number, including other names
1-Isopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 97% (CAS 777063-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633887-250mg |
| cas | 777063-41-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A633887 |
1-(3-methylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 777063-41-9) is a chemical compound with the molecular formula C14H25BN2O2 and a molecular weight of 264.17 g/mol. IUPAC name: 1-(3-methylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: YFNOUGJZNHTYAD-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O2 |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 1-(3-methylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | YFNOUGJZNHTYAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCC(C)C |
Computed by PubChem (NCBI)