CAS 847818-77-3 appears in our catalog under these names: 1-Isopentyl-1H-pyrazole-5-boronic acid, pinacol ester, 98%, 1-(3-Methylbutyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
1-(3-methylbutyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-77-3) is a chemical compound with the molecular formula C14H25BN2O2 and a molecular weight of 264.17 g/mol. IUPAC name: 1-(3-methylbutyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: GUIPYLOXXJTKQD-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O2 |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 1-(3-methylbutyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | GUIPYLOXXJTKQD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2CCC(C)C |
Computed by PubChem (NCBI)