cas: 879487-10-2 — see every product listed under this CAS number, including other names
1-Isopropyl-1H-pyrazole-4-boronic acid pinacol ester, 97% (CAS 879487-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 445090010 |
| cas | 879487-10-2 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 712.71 Pln | |
| Thermo Scientific (Acros) | 5g | 2209.41 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 877.83 Pln | |
| Fluorochem | 100g | 3236.38 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 879487-10-2) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 1-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: OGYYMVGDKVJYSU-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | OGYYMVGDKVJYSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)C |
Computed by PubChem (NCBI)