cas: 1282518-60-8 — see every product listed under this CAS number, including other names
1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1282518-60-8) is a chemical reagent available from Chemat. Available pack sizes: 250g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XW9-250g |
| cas | 1282518-60-8 |
| size | 250g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 1994.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 890.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1282518-60-8) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ZKZJXVGTTZXHGX-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ZKZJXVGTTZXHGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C(C)C |
Computed by PubChem (NCBI)