cas: 1349151-98-9 — see every product listed under this CAS number, including other names
1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one, 98%, 98% (CAS 1349151-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110VVW-100mg |
| cas | 1349151-98-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (CAS 1349151-98-9) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: 1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one. InChIKey: MPMZBWLBVFEODR-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 1-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| InChIKey | MPMZBWLBVFEODR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=O)C=C2)C(C)C |
Computed by PubChem (NCBI)