cas: 811440-77-4 — see every product listed under this CAS number, including other names
1-Isopropylcyclohexyl methacrylate 98% (CAS 811440-77-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1356793-250mg |
| cas | 811440-77-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 809.81 Pln | |
| Ambeed | 5g | 2272.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1356793 |
(1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate (CAS 811440-77-4) is a chemical compound with the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. IUPAC name: (1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate. InChIKey: KDSLFWBFCGYUIQ-UHFFFAOYSA-N.
| Molecular formula | C13H22O2 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | (1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate |
| InChIKey | KDSLFWBFCGYUIQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1(CCCCC1)OC(=O)C(=C)C |
Computed by PubChem (NCBI)