1-Methyl-1H-indazole-6-carbonitrile, 98%, 98%
cas: 267413-29-6 — see every product listed under this CAS number, including other names
1-Methyl-1H-indazole-6-carbonitrile, 98%, 98% (CAS 267413-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CGZH-100mg |
| cas | 267413-29-6 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 500mg | 482.00 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2061.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methylindazole-6-carbonitrile (CAS 267413-29-6) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 1-methylindazole-6-carbonitrile. InChIKey: WMKXQAVXMOAOAG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 1-methylindazole-6-carbonitrile |
| InChIKey | WMKXQAVXMOAOAG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C#N)C=N1 |
Computed by PubChem (NCBI)