cas: 384-46-3 — see every product listed under this CAS number, including other names
1-Methyl-2-(trifluoromethyl)-1H-benzo[d]imidazole, 98%, 98% (CAS 384-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLZH-1g |
| cas | 384-46-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1907.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methyl-2-(trifluoromethyl)benzimidazole (CAS 384-46-3) is a chemical compound with the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. IUPAC name: 1-methyl-2-(trifluoromethyl)benzimidazole. InChIKey: YKKYRNSRLGCTDO-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 1-methyl-2-(trifluoromethyl)benzimidazole |
| InChIKey | YKKYRNSRLGCTDO-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N=C1C(F)(F)F |
Computed by PubChem (NCBI)