CAS 73221-15-5 is the registry number for Imidazo[1,2-a]pyridine, 7-methyl-2-(trifluoromethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 73221-15-5) is a chemical compound with the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. IUPAC name: 7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: NDSVXSIFMFVDRJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | NDSVXSIFMFVDRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C(F)(F)F |
Computed by PubChem (NCBI)