cas: 203389-27-9 — see every product listed under this CAS number, including other names
1-Methyl-3-octylimidazolium nitrate, 97%, 97% (CAS 203389-27-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1139UG-5g |
| cas | 203389-27-9 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 304.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methyl-3-octylimidazol-1-ium nitrate (CAS 203389-27-9) is a chemical compound with the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. IUPAC name: 1-methyl-3-octylimidazol-1-ium nitrate. InChIKey: NQHPXYPSGSMQMA-UHFFFAOYSA-N.
| Molecular formula | C12H23N3O3 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-methyl-3-octylimidazol-1-ium nitrate |
| InChIKey | NQHPXYPSGSMQMA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C=C[N+](=C1)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)