CAS 203389-27-9 appears in our catalog under these names: 1-Octyl-3-methylimidazolium nitrate, 95%, 1-Methyl-3-octylimidazolium nitrate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g.
1-methyl-3-octylimidazol-1-ium nitrate (CAS 203389-27-9) is a chemical compound with the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. IUPAC name: 1-methyl-3-octylimidazol-1-ium nitrate. InChIKey: NQHPXYPSGSMQMA-UHFFFAOYSA-N.
| Molecular formula | C12H23N3O3 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-methyl-3-octylimidazol-1-ium nitrate |
| InChIKey | NQHPXYPSGSMQMA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C=C[N+](=C1)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)