cas: 244193-48-4 — see every product listed under this CAS number, including other names
1-Methyl-3-propylimidazolium Tetrafluoroborate, >98.0%(HPLC)(N) (CAS 244193-48-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3036-5G |
| cas | 244193-48-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 193.59 Pln | |
| TCI | 25g | 375.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
1-methyl-3-propylimidazol-1-ium tetrafluoroborate (CAS 244193-48-4) is a chemical compound with the molecular formula C7H13BF4N2 and a molecular weight of 212.00 g/mol. IUPAC name: 1-methyl-3-propylimidazol-1-ium tetrafluoroborate. InChIKey: XFTQQJUVYZPNRC-UHFFFAOYSA-N.
| Molecular formula | C7H13BF4N2 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | 1-methyl-3-propylimidazol-1-ium tetrafluoroborate |
| InChIKey | XFTQQJUVYZPNRC-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCCN1C=C[N+](=C1)C |
Computed by PubChem (NCBI)