CAS 434937-12-9 appears in our catalog under these names: 1-(Cyanomethyl)piperidinium tetrafluoroborate, 98%, 1–(Cyanomethyl)piperidinium Tetrafluoroborate, 1-(Cyanomethyl)piperidinium Tetrafluoroborate, >98.0%(N), 1-(Cyanomethyl)piperidinium Tetrafluoroborate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-piperidin-1-ium-1-ylacetonitrile tetrafluoroborate (CAS 434937-12-9) is a chemical compound with the molecular formula C7H13BF4N2 and a molecular weight of 212.00 g/mol. IUPAC name: 2-piperidin-1-ium-1-ylacetonitrile tetrafluoroborate. InChIKey: HSIKBRNFKUNHIN-UHFFFAOYSA-O.
| Molecular formula | C7H13BF4N2 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | 2-piperidin-1-ium-1-ylacetonitrile tetrafluoroborate |
| InChIKey | HSIKBRNFKUNHIN-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C1CC[NH+](CC1)CC#N |
Computed by PubChem (NCBI)