cas: 1218790-53-4 — see every product listed under this CAS number, including other names
1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole 95% (CAS 1218790-53-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A565267-250mg |
| cas | 1218790-53-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1633.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A565267 |
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole (CAS 1218790-53-4) is a chemical compound with the molecular formula C11H16BF3N2O2 and a molecular weight of 276.07 g/mol. IUPAC name: 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole. InChIKey: MUZZCKPFJNQCIH-UHFFFAOYSA-N.
| Molecular formula | C11H16BF3N2O2 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole |
| InChIKey | MUZZCKPFJNQCIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C(F)(F)F)C |
Computed by PubChem (NCBI)