cas: 1218790-53-4 — see every product listed under this CAS number, including other names
1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole, 97%, 97% (CAS 1218790-53-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11270R-100mg |
| cas | 1218790-53-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 25g | 1456.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole (CAS 1218790-53-4) is a chemical compound with the molecular formula C11H16BF3N2O2 and a molecular weight of 276.07 g/mol. IUPAC name: 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole. InChIKey: MUZZCKPFJNQCIH-UHFFFAOYSA-N.
| Molecular formula | C11H16BF3N2O2 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole |
| InChIKey | MUZZCKPFJNQCIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C(F)(F)F)C |
Computed by PubChem (NCBI)