cas: 918524-63-7 — see every product listed under this CAS number, including other names
1-Methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]piperazine, 95% (CAS 918524-63-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024450-1G |
| cas | 918524-63-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 25g | 955.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (CAS 918524-63-7) is a chemical compound with the molecular formula C16H26BN3O2 and a molecular weight of 303.2 g/mol. IUPAC name: 1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine. InChIKey: KVQXFNGVIIPCSX-UHFFFAOYSA-N.
| Molecular formula | C16H26BN3O2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| InChIKey | KVQXFNGVIIPCSX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCN(CC3)C |
Computed by PubChem (NCBI)