cas: 918524-63-7 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)pyridine-5-boronic acid pinacol ester, 97%, 97% (CAS 918524-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGWZ-100mg |
| cas | 918524-63-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 688.40 Pln | |
| Chemat | 10g | 318.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (CAS 918524-63-7) is a chemical compound with the molecular formula C16H26BN3O2 and a molecular weight of 303.2 g/mol. IUPAC name: 1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine. InChIKey: KVQXFNGVIIPCSX-UHFFFAOYSA-N.
| Molecular formula | C16H26BN3O2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| InChIKey | KVQXFNGVIIPCSX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCN(CC3)C |
Computed by PubChem (NCBI)