cas: 4531-54-8 — see every product listed under this CAS number, including other names
1-Methyl-4-nitro-1H-imidazol-5-amine, 95%, 95% (CAS 4531-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJFT-100mg |
| cas | 4531-54-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1202.00 Pln | |
| Chemat | 10g | 2142.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-methyl-5-nitroimidazol-4-amine (CAS 4531-54-8) is a chemical compound with the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. IUPAC name: 3-methyl-5-nitroimidazol-4-amine. InChIKey: GJVMTMXQJDQJSS-UHFFFAOYSA-N.
| Molecular formula | C4H6N4O2 |
|---|---|
| Molecular weight | 142.12 g/mol |
| IUPAC name | 3-methyl-5-nitroimidazol-4-amine |
| InChIKey | GJVMTMXQJDQJSS-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)