CAS 26621-46-5 is the registry number for 1,5-Dimethyl-3-nitro-1h-[1,2,4]triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,5-dimethyl-3-nitro-1,2,4-triazole (CAS 26621-46-5) is a chemical compound with the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. IUPAC name: 1,5-dimethyl-3-nitro-1,2,4-triazole. InChIKey: QUHFRWOVIJITEZ-UHFFFAOYSA-N.
| Molecular formula | C4H6N4O2 |
|---|---|
| Molecular weight | 142.12 g/mol |
| IUPAC name | 1,5-dimethyl-3-nitro-1,2,4-triazole |
| InChIKey | QUHFRWOVIJITEZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)