cas: 1220696-34-3 — see every product listed under this CAS number, including other names
1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine 95% (CAS 1220696-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106036-100mg |
| cas | 1220696-34-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1455.06 Pln | |
| Ambeed | 25g | 6355.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106036 |
1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (CAS 1220696-34-3) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine. InChIKey: HQQDRRKOLDTGHY-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| InChIKey | HQQDRRKOLDTGHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(C=C3)C |
Computed by PubChem (NCBI)