cas: 61995-20-8 — see every product listed under this CAS number, including other names
1-N-Cbz-3-Piperidone, 95% (CAS 61995-20-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011609-1G |
| cas | 61995-20-8 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 117.68 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 50g | 351.98 Pln | |
| Fluorochem | 100g | 617.51 Pln | |
| Fluorochem | 250g | 1424.52 Pln | |
| Fluorochem | 500g | 2767.79 Pln | |
| Fluorochem | 1kg | 4355.78 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Benzyl 3-oxopiperidine-1-carboxylate (CAS 61995-20-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: benzyl 3-oxopiperidine-1-carboxylate. InChIKey: ALXLNFWWLXCXSK-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | benzyl 3-oxopiperidine-1-carboxylate |
| InChIKey | ALXLNFWWLXCXSK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)